C28H26N6O5S — CID 23296501
ethyl 2-[2-[(4-carbamimidoylphenoxy)methyl]-5-(quinolin-8-ylsulfonylamino)benzimidazol-1-yl]acetate (PubChem CID 23296501) has the molecular formula C28H26N6O5S and a molecular weight of 558.62 g/mol. Its IUPAC name is ethyl 2-[2-[(4-carbamimidoylphenoxy)methyl]-5-(quinolin-8-ylsulfonylamino)benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-carbamimidoylphenoxy)methyl]-5-(quinolin-8-ylsulfonylamino)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 23296501 |
| Molecular Formula | C28H26N6O5S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | ethyl 2-[2-[(4-carbamimidoylphenoxy)methyl]-5-(quinolin-8-ylsulfonylamino)benzimidazol-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(OCc2nc3cc(NS(=O)(=O)c4cccc5cccnc45)ccc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C28H26N6O5S/c1-2-38-26(35)16-34-23-13-10-20(33-40(36,37)24-7-3-5-18-6-4-14-31-27(18)24)15-22(23)32-25(34)17-39-21-11-8-19(9-12-21)28(29)30/h3-15,33H,2,16-17H2,1H3,(H3,29,30) |
| InChIKey | GQSHMSFUCQSTTO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 162.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|