C32H34IN5O4S — CID 70065928
methyl 2-[[1-[3-(4-carbamimidoylphenyl)propyl]-2,3-dimethylindol-5-yl]amino]-2-quinolin-8-ylsulfonylacetate;hydroiodide (PubChem CID 70065928) has the molecular formula C32H34IN5O4S and a molecular weight of 711.63 g/mol. Its IUPAC name is methyl 2-[[1-[3-(4-carbamimidoylphenyl)propyl]-2,3-dimethylindol-5-yl]amino]-2-quinolin-8-ylsulfonylacetate;hydroiodide.
| Compound Name | methyl 2-[[1-[3-(4-carbamimidoylphenyl)propyl]-2,3-dimethylindol-5-yl]amino]-2-quinolin-8-ylsulfonylacetate;hydroiodide |
|---|---|
| PubChem CID | 70065928 |
| Molecular Formula | C32H34IN5O4S |
| Molecular Weight | 711.63 g/mol |
| Exact Mass | 711.14 |
| IUPAC Name | methyl 2-[[1-[3-(4-carbamimidoylphenyl)propyl]-2,3-dimethylindol-5-yl]amino]-2-quinolin-8-ylsulfonylacetate;hydroiodide |
| SMILES | I.[H]/N=C(\N)c1ccc(CCCn2c(C)c(C)c3cc(NC(C(=O)OC)S(=O)(=O)c4cccc5cccnc45)ccc32)cc1 |
| InChI | InChI=1S/C32H33N5O4S.HI/c1-20-21(2)37(18-6-7-22-11-13-24(14-12-22)30(33)34)27-16-15-25(19-26(20)27)36-31(32(38)41-3)42(39,40)28-10-4-8-23-9-5-17-35-29(23)28;/h4-5,8-17,19,31,36H,6-7,18H2,1-3H3,(H3,33,34);1H |
| InChIKey | HGWAHNAHHKFYCM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|