C25H24ClN7O2S — CID 23296474
4-[2-[1-methyl-6-(quinolin-8-ylsulfonylamino)imidazo[4,5-b]pyridin-2-yl]ethyl]benzenecarboximidamide;hydrochloride (PubChem CID 23296474) has the molecular formula C25H24ClN7O2S and a molecular weight of 522.03 g/mol. Its IUPAC name is 4-[2-[1-methyl-6-(quinolin-8-ylsulfonylamino)imidazo[4,5-b]pyridin-2-yl]ethyl]benzenecarboximidamide;hydrochloride.
| Compound Name | 4-[2-[1-methyl-6-(quinolin-8-ylsulfonylamino)imidazo[4,5-b]pyridin-2-yl]ethyl]benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 23296474 |
| Molecular Formula | C25H24ClN7O2S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-[2-[1-methyl-6-(quinolin-8-ylsulfonylamino)imidazo[4,5-b]pyridin-2-yl]ethyl]benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCc2nc3ncc(NS(=O)(=O)c4cccc5cccnc45)cc3n2C)cc1 |
| InChI | InChI=1S/C25H23N7O2S.ClH/c1-32-20-14-19(31-35(33,34)21-6-2-4-17-5-3-13-28-23(17)21)15-29-25(20)30-22(32)12-9-16-7-10-18(11-8-16)24(26)27;/h2-8,10-11,13-15,31H,9,12H2,1H3,(H3,26,27);1H |
| InChIKey | XPWJMAZBDLDGHU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|