C26H23ClN6O4S — CID 70065019
[1-methyl-5-(quinolin-8-ylsulfonylamino)indol-3-yl] N-(4-carbamimidoylphenyl)carbamate;hydrochloride (PubChem CID 70065019) has the molecular formula C26H23ClN6O4S and a molecular weight of 551.03 g/mol. Its IUPAC name is [1-methyl-5-(quinolin-8-ylsulfonylamino)indol-3-yl] N-(4-carbamimidoylphenyl)carbamate;hydrochloride.
| Compound Name | [1-methyl-5-(quinolin-8-ylsulfonylamino)indol-3-yl] N-(4-carbamimidoylphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 70065019 |
| Molecular Formula | C26H23ClN6O4S |
| Molecular Weight | 551.03 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [1-methyl-5-(quinolin-8-ylsulfonylamino)indol-3-yl] N-(4-carbamimidoylphenyl)carbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(NC(=O)Oc2cn(C)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc23)cc1 |
| InChI | InChI=1S/C26H22N6O4S.ClH/c1-32-15-22(36-26(33)30-18-9-7-17(8-10-18)25(27)28)20-14-19(11-12-21(20)32)31-37(34,35)23-6-2-4-16-5-3-13-29-24(16)23;/h2-15,31H,1H3,(H3,27,28)(H,30,33);1H |
| InChIKey | ZTRLMYLQXQVKRH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.03 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|