C27H26ClN7O3S — CID 70064240
N-[(4-carbamimidoylphenyl)methyl]-5-(2-isoquinolin-5-ylsulfonylhydrazinyl)-1-methylindole-3-carboxamide;hydrochloride (PubChem CID 70064240) has the molecular formula C27H26ClN7O3S and a molecular weight of 564.07 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-5-(2-isoquinolin-5-ylsulfonylhydrazinyl)-1-methylindole-3-carboxamide;hydrochloride.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-5-(2-isoquinolin-5-ylsulfonylhydrazinyl)-1-methylindole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70064240 |
| Molecular Formula | C27H26ClN7O3S |
| Molecular Weight | 564.07 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-5-(2-isoquinolin-5-ylsulfonylhydrazinyl)-1-methylindole-3-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)c2cn(C)c3ccc(NNS(=O)(=O)c4cccc5cnccc45)cc23)cc1 |
| InChI | InChI=1S/C27H25N7O3S.ClH/c1-34-16-23(27(35)31-14-17-5-7-18(8-6-17)26(28)29)22-13-20(9-10-24(22)34)32-33-38(36,37)25-4-2-3-19-15-30-12-11-21(19)25;/h2-13,15-16,32-33H,14H2,1H3,(H3,28,29)(H,31,35);1H |
| InChIKey | XWHMAIVSSJGBAS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|