C32H31N5O5S — CID 70063431
ethyl 2-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate (PubChem CID 70063431) has the molecular formula C32H31N5O5S and a molecular weight of 597.70 g/mol. Its IUPAC name is ethyl 2-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate.
| Compound Name | ethyl 2-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate |
|---|---|
| PubChem CID | 70063431 |
| Molecular Formula | C32H31N5O5S |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | ethyl 2-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)c2cn(C)c3ccc(N(CC(=O)OCC)S(=O)(=O)c4cccc5cnccc45)cc23)cc1 |
| InChI | InChI=1S/C32H31N5O5S/c1-3-42-31(39)20-37(43(40,41)30-6-4-5-23-18-35-16-15-25(23)30)24-12-13-28-26(17-24)27(19-36(28)2)29(38)14-9-21-7-10-22(11-8-21)32(33)34/h4-8,10-13,15-19H,3,9,14,20H2,1-2H3,(H3,33,34) |
| InChIKey | NQTUMDYMAAGOSQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|