C31H31ClN6O5S — CID 70062608
ethyl 2-[[3-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate;hydrochloride (PubChem CID 70062608) has the molecular formula C31H31ClN6O5S and a molecular weight of 635.15 g/mol. Its IUPAC name is ethyl 2-[[3-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate;hydrochloride.
| Compound Name | ethyl 2-[[3-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate;hydrochloride |
|---|---|
| PubChem CID | 70062608 |
| Molecular Formula | C31H31ClN6O5S |
| Molecular Weight | 635.15 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | ethyl 2-[[3-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-methylindol-5-yl]-isoquinolin-5-ylsulfonylamino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CNC(=O)c2cn(C)c3ccc(N(CC(=O)OCC)S(=O)(=O)c4cccc5cnccc45)cc23)cc1 |
| InChI | InChI=1S/C31H30N6O5S.ClH/c1-3-42-29(38)19-37(43(40,41)28-6-4-5-22-17-34-14-13-24(22)28)23-11-12-27-25(15-23)26(18-36(27)2)31(39)35-16-20-7-9-21(10-8-20)30(32)33;/h4-15,17-18H,3,16,19H2,1-2H3,(H3,32,33)(H,35,39);1H |
| InChIKey | ZTVFSCAMKZHNCX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 160.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|