C28H28ClN5O4 — CID 70066051
ethyl 2-[[3-[2-(4-carbamimidoylphenyl)acetyl]-1-methylindol-6-yl]-(pyridine-3-carbonyl)amino]acetate;hydrochloride (PubChem CID 70066051) has the molecular formula C28H28ClN5O4 and a molecular weight of 534.02 g/mol. Its IUPAC name is ethyl 2-[[3-[2-(4-carbamimidoylphenyl)acetyl]-1-methylindol-6-yl]-(pyridine-3-carbonyl)amino]acetate;hydrochloride.
| Compound Name | ethyl 2-[[3-[2-(4-carbamimidoylphenyl)acetyl]-1-methylindol-6-yl]-(pyridine-3-carbonyl)amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 70066051 |
| Molecular Formula | C28H28ClN5O4 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | ethyl 2-[[3-[2-(4-carbamimidoylphenyl)acetyl]-1-methylindol-6-yl]-(pyridine-3-carbonyl)amino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CC(=O)c2cn(C)c3cc(N(CC(=O)OCC)C(=O)c4cccnc4)ccc23)cc1 |
| InChI | InChI=1S/C28H27N5O4.ClH/c1-3-37-26(35)17-33(28(36)20-5-4-12-31-15-20)21-10-11-22-23(16-32(2)24(22)14-21)25(34)13-18-6-8-19(9-7-18)27(29)30;/h4-12,14-16H,3,13,17H2,1-2H3,(H3,29,30);1H |
| InChIKey | IOXJCUZVNQUWIK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|