C29H28N4O4 — CID 23296403
ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenoxy)methyl]-4-methylquinolin-7-yl]amino]acetate (PubChem CID 23296403) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenoxy)methyl]-4-methylquinolin-7-yl]amino]acetate.
| Compound Name | ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenoxy)methyl]-4-methylquinolin-7-yl]amino]acetate |
|---|---|
| PubChem CID | 23296403 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenoxy)methyl]-4-methylquinolin-7-yl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(OCc2cc(C)c3ccc(N(CC(=O)OCC)C(=O)c4ccccc4)cc3n2)cc1 |
| InChI | InChI=1S/C29H28N4O4/c1-3-36-27(34)17-33(29(35)21-7-5-4-6-8-21)23-11-14-25-19(2)15-22(32-26(25)16-23)18-37-24-12-9-20(10-13-24)28(30)31/h4-16H,3,17-18H2,1-2H3,(H3,30,31) |
| InChIKey | GUFOSAFAGVPOIA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|