C27H27N5O3S — CID 70077385
ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenyl)methylsulfanyl]-4-methyl-1H-benzimidazol-5-yl]amino]acetate (PubChem CID 70077385) has the molecular formula C27H27N5O3S and a molecular weight of 501.61 g/mol. Its IUPAC name is ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenyl)methylsulfanyl]-4-methyl-1H-benzimidazol-5-yl]amino]acetate.
| Compound Name | ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenyl)methylsulfanyl]-4-methyl-1H-benzimidazol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 70077385 |
| Molecular Formula | C27H27N5O3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | ethyl 2-[benzoyl-[2-[(4-carbamimidoylphenyl)methylsulfanyl]-4-methyl-1H-benzimidazol-5-yl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CSc2nc3c(C)c(N(CC(=O)OCC)C(=O)c4ccccc4)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H27N5O3S/c1-3-35-23(33)15-32(26(34)20-7-5-4-6-8-20)22-14-13-21-24(17(22)2)31-27(30-21)36-16-18-9-11-19(12-10-18)25(28)29/h4-14H,3,15-16H2,1-2H3,(H3,28,29)(H,30,31) |
| InChIKey | XAOKVYHSFHNJGU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|