C27H26ClN5O5 — CID 70095041
ethyl 2-[N-[[2-(4-carbamimidoylbenzoyl)-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl]anilino]acetate;hydrochloride (PubChem CID 70095041) has the molecular formula C27H26ClN5O5 and a molecular weight of 535.99 g/mol. Its IUPAC name is ethyl 2-[N-[[2-(4-carbamimidoylbenzoyl)-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl]anilino]acetate;hydrochloride.
| Compound Name | ethyl 2-[N-[[2-(4-carbamimidoylbenzoyl)-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl]anilino]acetate;hydrochloride |
|---|---|
| PubChem CID | 70095041 |
| Molecular Formula | C27H26ClN5O5 |
| Molecular Weight | 535.99 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | ethyl 2-[N-[[2-(4-carbamimidoylbenzoyl)-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl]anilino]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(C(=O)c2nc3c(C)c(OC(=O)N(CC(=O)OCC)c4ccccc4)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H25N5O5.ClH/c1-3-36-22(33)15-32(19-7-5-4-6-8-19)27(35)37-21-14-13-20-23(16(21)2)31-26(30-20)24(34)17-9-11-18(12-10-17)25(28)29;/h4-14H,3,15H2,1-2H3,(H3,28,29)(H,30,31);1H |
| InChIKey | CESCAHLMNUUKNQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.99 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|