C25H32ClN5O6S — CID 70097219
ethyl 3-[[2-[(4-carbamimidoylphenyl)sulfonylmethyl]-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl-propylamino]propanoate;hydrochloride (PubChem CID 70097219) has the molecular formula C25H32ClN5O6S and a molecular weight of 566.08 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylphenyl)sulfonylmethyl]-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl-propylamino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)sulfonylmethyl]-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl-propylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 70097219 |
| Molecular Formula | C25H32ClN5O6S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)sulfonylmethyl]-4-methyl-1H-benzimidazol-5-yl]oxycarbonyl-propylamino]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(S(=O)(=O)Cc2nc3c(C)c(OC(=O)N(CCC)CCC(=O)OCC)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C25H31N5O6S.ClH/c1-4-13-30(14-12-22(31)35-5-2)25(32)36-20-11-10-19-23(16(20)3)29-21(28-19)15-37(33,34)18-8-6-17(7-9-18)24(26)27;/h6-11H,4-5,12-15H2,1-3H3,(H3,26,27)(H,28,29);1H |
| InChIKey | JYAQUTVLFBJRTE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 168.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|