C30H32ClN5O5 — CID 70064736
ethyl 3-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]oxycarbonyl-pyridin-2-ylamino]propanoate;hydrochloride (PubChem CID 70064736) has the molecular formula C30H32ClN5O5 and a molecular weight of 578.07 g/mol. Its IUPAC name is ethyl 3-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]oxycarbonyl-pyridin-2-ylamino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]oxycarbonyl-pyridin-2-ylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 70064736 |
| Molecular Formula | C30H32ClN5O5 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | ethyl 3-[[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl]oxycarbonyl-pyridin-2-ylamino]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCC(=O)c2cn(C)c3ccc(OC(=O)N(CCC(=O)OCC)c4ccccn4)cc23)cc1 |
| InChI | InChI=1S/C30H31N5O5.ClH/c1-3-39-28(37)15-17-35(27-6-4-5-16-33-27)30(38)40-22-12-13-25-23(18-22)24(19-34(25)2)26(36)14-9-20-7-10-21(11-8-20)29(31)32;/h4-8,10-13,16,18-19H,3,9,14-15,17H2,1-2H3,(H3,31,32);1H |
| InChIKey | OEZDRUSOVXKSHN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|