C26H25ClN4O3 — CID 70066202
[3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl] N-phenylcarbamate;hydrochloride (PubChem CID 70066202) has the molecular formula C26H25ClN4O3 and a molecular weight of 476.96 g/mol. Its IUPAC name is [3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl] N-phenylcarbamate;hydrochloride.
| Compound Name | [3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl] N-phenylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 70066202 |
| Molecular Formula | C26H25ClN4O3 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [3-[3-(4-carbamimidoylphenyl)propanoyl]-1-methylindol-5-yl] N-phenylcarbamate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCC(=O)c2cn(C)c3ccc(OC(=O)Nc4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C26H24N4O3.ClH/c1-30-16-22(24(31)14-9-17-7-10-18(11-8-17)25(27)28)21-15-20(12-13-23(21)30)33-26(32)29-19-5-3-2-4-6-19;/h2-8,10-13,15-16H,9,14H2,1H3,(H3,27,28)(H,29,32);1H |
| InChIKey | IONNNFYHQBLEFI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|