C20H19N3O4 — CID 70064762
[3-[3-(4-carbamimidoylphenyl)propanoyl]-2-methyl-1H-indol-5-yl] hydrogen carbonate (PubChem CID 70064762) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is [3-[3-(4-carbamimidoylphenyl)propanoyl]-2-methyl-1H-indol-5-yl] hydrogen carbonate.
| Compound Name | [3-[3-(4-carbamimidoylphenyl)propanoyl]-2-methyl-1H-indol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70064762 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [3-[3-(4-carbamimidoylphenyl)propanoyl]-2-methyl-1H-indol-5-yl] hydrogen carbonate |
| SMILES | [H]/N=C(\N)c1ccc(CCC(=O)c2c(C)[nH]c3ccc(OC(=O)O)cc23)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-11-18(15-10-14(27-20(25)26)7-8-16(15)23-11)17(24)9-4-12-2-5-13(6-3-12)19(21)22/h2-3,5-8,10,23H,4,9H2,1H3,(H3,21,22)(H,25,26) |
| InChIKey | OYDBHRGDXNYVMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|