C23H20N4O — CID 70068069
5-carbamimidoyl-2-methyl-N-(4-phenylphenyl)-1H-indole-3-carboxamide (PubChem CID 70068069) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-carbamimidoyl-2-methyl-N-(4-phenylphenyl)-1H-indole-3-carboxamide.
| Compound Name | 5-carbamimidoyl-2-methyl-N-(4-phenylphenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 70068069 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 5-carbamimidoyl-2-methyl-N-(4-phenylphenyl)-1H-indole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc2[nH]c(C)c(C(=O)Nc3ccc(-c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C23H20N4O/c1-14-21(19-13-17(22(24)25)9-12-20(19)26-14)23(28)27-18-10-7-16(8-11-18)15-5-3-2-4-6-15/h2-13,26H,1H3,(H3,24,25)(H,27,28) |
| InChIKey | RYXNYSXEXBJEKB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|