C22H20N6O3S — CID 151427042
6-carbamimidoyl-2-methyl-N-[4-(2-sulfamoylphenyl)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 151427042) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 6-carbamimidoyl-2-methyl-N-[4-(2-sulfamoylphenyl)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-carbamimidoyl-2-methyl-N-[4-(2-sulfamoylphenyl)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 151427042 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 6-carbamimidoyl-2-methyl-N-[4-(2-sulfamoylphenyl)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C22H20N6O3S/c1-12-26-18-11-14(21(23)24)10-17(20(18)27-12)22(29)28-15-8-6-13(7-9-15)16-4-2-3-5-19(16)32(25,30)31/h2-11H,1H3,(H3,23,24)(H,26,27)(H,28,29)(H2,25,30,31) |
| InChIKey | PBSUEGKDMMAICD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 167.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|