C26H21ClN4O4S — CID 22596395
2-(3-carbamimidoylphenoxy)-5-chloro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide (PubChem CID 22596395) has the molecular formula C26H21ClN4O4S and a molecular weight of 521.00 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-5-chloro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-5-chloro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 22596395 |
| Molecular Formula | C26H21ClN4O4S |
| Molecular Weight | 521.00 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-5-chloro-N-[4-(2-sulfamoylphenyl)phenyl]benzamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2ccc(Cl)cc2C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C26H21ClN4O4S/c27-18-10-13-23(35-20-5-3-4-17(14-20)25(28)29)22(15-18)26(32)31-19-11-8-16(9-12-19)21-6-1-2-7-24(21)36(30,33)34/h1-15H,(H3,28,29)(H,31,32)(H2,30,33,34) |
| InChIKey | GIMYYUSGVPGFHW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|