C25H20FN5O3S — CID 10300003
2-(3-carbamimidoyl-4-fluorophenyl)-N-[4-(2-sulfamoylphenyl)phenyl]pyridine-4-carboxamide (PubChem CID 10300003) has the molecular formula C25H20FN5O3S and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-(3-carbamimidoyl-4-fluorophenyl)-N-[4-(2-sulfamoylphenyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(3-carbamimidoyl-4-fluorophenyl)-N-[4-(2-sulfamoylphenyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10300003 |
| Molecular Formula | C25H20FN5O3S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-(3-carbamimidoyl-4-fluorophenyl)-N-[4-(2-sulfamoylphenyl)phenyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C(\N)c1cc(-c2cc(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3)ccn2)ccc1F |
| InChI | InChI=1S/C25H20FN5O3S/c26-21-10-7-16(13-20(21)24(27)28)22-14-17(11-12-30-22)25(32)31-18-8-5-15(6-9-18)19-3-1-2-4-23(19)35(29,33)34/h1-14H,(H3,27,28)(H,31,32)(H2,29,33,34) |
| InChIKey | XLKJEVKKXUBJHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|