C26H27N5O5S — CID 10697320
3-(3-carbamimidoylphenyl)-5-(2-methoxyethyl)-N-[4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 10697320) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-5-(2-methoxyethyl)-N-[4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-5-(2-methoxyethyl)-N-[4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 10697320 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-5-(2-methoxyethyl)-N-[4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(CCOC)(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3)C2)c1 |
| InChI | InChI=1S/C26H27N5O5S/c1-35-14-13-26(16-22(31-36-26)18-5-4-6-19(15-18)24(27)28)25(32)30-20-11-9-17(10-12-20)21-7-2-3-8-23(21)37(29,33)34/h2-12,15H,13-14,16H2,1H3,(H3,27,28)(H,30,32)(H2,29,33,34) |
| InChIKey | KUXGIJZKHAPBOL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 169.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|