C22H21N7O4S — CID 100937648
3-(3-carbamimidoylphenyl)-5-methyl-N-[5-(2-sulfamoylphenyl)pyrimidin-2-yl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 100937648) has the molecular formula C22H21N7O4S and a molecular weight of 479.52 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-5-methyl-N-[5-(2-sulfamoylphenyl)pyrimidin-2-yl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-5-methyl-N-[5-(2-sulfamoylphenyl)pyrimidin-2-yl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 100937648 |
| Molecular Formula | C22H21N7O4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-5-methyl-N-[5-(2-sulfamoylphenyl)pyrimidin-2-yl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(C)(C(=O)Nc3ncc(-c4ccccc4S(N)(=O)=O)cn3)C2)c1 |
| InChI | InChI=1S/C22H21N7O4S/c1-22(10-17(29-33-22)13-5-4-6-14(9-13)19(23)24)20(30)28-21-26-11-15(12-27-21)16-7-2-3-8-18(16)34(25,31)32/h2-9,11-12H,10H2,1H3,(H3,23,24)(H2,25,31,32)(H,26,27,28,30) |
| InChIKey | GUEGYEURZINVQD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|