C25H25N5O4S — CID 21218735
3-(3-carbamimidoylphenyl)-5-methyl-N-[2-methyl-4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 21218735) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-5-methyl-N-[2-methyl-4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-5-methyl-N-[2-methyl-4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 21218735 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-5-methyl-N-[2-methyl-4-(2-sulfamoylphenyl)phenyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(C)(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cc3C)C2)c1 |
| InChI | InChI=1S/C25H25N5O4S/c1-15-12-16(19-8-3-4-9-22(19)35(28,32)33)10-11-20(15)29-24(31)25(2)14-21(30-34-25)17-6-5-7-18(13-17)23(26)27/h3-13H,14H2,1-2H3,(H3,26,27)(H,29,31)(H2,28,32,33) |
| InChIKey | YRJHPUSAPOJDBW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|