C26H20F4N8O4S — CID 21218700
3-(3-carbamimidoylphenyl)-N-[2-fluoro-4-[2-(trifluoromethylsulfonyl)phenyl]phenyl]-5-(tetrazol-1-ylmethyl)-4H-1,2-oxazole-5-carboxamide (PubChem CID 21218700) has the molecular formula C26H20F4N8O4S and a molecular weight of 616.56 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-N-[2-fluoro-4-[2-(trifluoromethylsulfonyl)phenyl]phenyl]-5-(tetrazol-1-ylmethyl)-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-N-[2-fluoro-4-[2-(trifluoromethylsulfonyl)phenyl]phenyl]-5-(tetrazol-1-ylmethyl)-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 21218700 |
| Molecular Formula | C26H20F4N8O4S |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-N-[2-fluoro-4-[2-(trifluoromethylsulfonyl)phenyl]phenyl]-5-(tetrazol-1-ylmethyl)-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(Cn3cnnn3)(C(=O)Nc3ccc(-c4ccccc4S(=O)(=O)C(F)(F)F)cc3F)C2)c1 |
| InChI | InChI=1S/C26H20F4N8O4S/c27-19-11-15(18-6-1-2-7-22(18)43(40,41)26(28,29)30)8-9-20(19)34-24(39)25(13-38-14-33-36-37-38)12-21(35-42-25)16-4-3-5-17(10-16)23(31)32/h1-11,14H,12-13H2,(H3,31,32)(H,34,39) |
| InChIKey | CWGQHSIZWSJILC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 178.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|