C24H24N6O5S — CID 10436294
3-(3-carbamimidoylphenyl)-5-(methoxymethyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide (PubChem CID 10436294) has the molecular formula C24H24N6O5S and a molecular weight of 508.56 g/mol. Its IUPAC name is 3-(3-carbamimidoylphenyl)-5-(methoxymethyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(3-carbamimidoylphenyl)-5-(methoxymethyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 10436294 |
| Molecular Formula | C24H24N6O5S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 3-(3-carbamimidoylphenyl)-5-(methoxymethyl)-N-[5-(2-sulfamoylphenyl)-2-pyridinyl]-4H-1,2-oxazole-5-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(COC)(C(=O)Nc3ccc(-c4ccccc4S(N)(=O)=O)cn3)C2)c1 |
| InChI | InChI=1S/C24H24N6O5S/c1-34-14-24(12-19(30-35-24)15-5-4-6-16(11-15)22(25)26)23(31)29-21-10-9-17(13-28-21)18-7-2-3-8-20(18)36(27,32)33/h2-11,13H,12,14H2,1H3,(H3,25,26)(H2,27,32,33)(H,28,29,31) |
| InChIKey | DEKNGEPVVQKQJB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 182.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|