C26H25N5O6S — CID 10604270
methyl 2-[3-(3-carbamimidoylphenyl)-5-[[4-(3-sulfamoylphenyl)phenyl]carbamoyl]-4H-1,2-oxazol-5-yl]acetate (PubChem CID 10604270) has the molecular formula C26H25N5O6S and a molecular weight of 535.58 g/mol. Its IUPAC name is methyl 2-[3-(3-carbamimidoylphenyl)-5-[[4-(3-sulfamoylphenyl)phenyl]carbamoyl]-4H-1,2-oxazol-5-yl]acetate.
| Compound Name | methyl 2-[3-(3-carbamimidoylphenyl)-5-[[4-(3-sulfamoylphenyl)phenyl]carbamoyl]-4H-1,2-oxazol-5-yl]acetate |
|---|---|
| PubChem CID | 10604270 |
| Molecular Formula | C26H25N5O6S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | methyl 2-[3-(3-carbamimidoylphenyl)-5-[[4-(3-sulfamoylphenyl)phenyl]carbamoyl]-4H-1,2-oxazol-5-yl]acetate |
| SMILES | [H]/N=C(\N)c1cccc(C2=NOC(CC(=O)OC)(C(=O)Nc3ccc(-c4cccc(S(N)(=O)=O)c4)cc3)C2)c1 |
| InChI | InChI=1S/C26H25N5O6S/c1-36-23(32)15-26(14-22(31-37-26)18-5-2-6-19(12-18)24(27)28)25(33)30-20-10-8-16(9-11-20)17-4-3-7-21(13-17)38(29,34)35/h2-13H,14-15H2,1H3,(H3,27,28)(H,30,33)(H2,29,34,35) |
| InChIKey | DVZTUQJDBGWRKP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 187.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|