C24H26N4O4S — CID 10162056
2-(3-carbamimidoylphenoxy)-N-[3-(3-sulfamoylphenyl)phenyl]pentanamide (PubChem CID 10162056) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[3-(3-sulfamoylphenyl)phenyl]pentanamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[3-(3-sulfamoylphenyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 10162056 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[3-(3-sulfamoylphenyl)phenyl]pentanamide |
| SMILES | [H]/N=C(\N)c1cccc(OC(CCC)C(=O)Nc2cccc(-c3cccc(S(N)(=O)=O)c3)c2)c1 |
| InChI | InChI=1S/C24H26N4O4S/c1-2-6-22(32-20-11-4-9-18(14-20)23(25)26)24(29)28-19-10-3-7-16(13-19)17-8-5-12-21(15-17)33(27,30)31/h3-5,7-15,22H,2,6H2,1H3,(H3,25,26)(H,28,29)(H2,27,30,31) |
| InChIKey | BXCQDLKQIHBEFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 148.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|