C23H28N4O3 — CID 10223170
2-(3-carbamimidoylphenoxy)-N-[4-(2-oxopiperidin-1-yl)phenyl]pentanamide (PubChem CID 10223170) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[4-(2-oxopiperidin-1-yl)phenyl]pentanamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[4-(2-oxopiperidin-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 10223170 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[4-(2-oxopiperidin-1-yl)phenyl]pentanamide |
| SMILES | [H]/N=C(\N)c1cccc(OC(CCC)C(=O)Nc2ccc(N3CCCCC3=O)cc2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-2-6-20(30-19-8-5-7-16(15-19)22(24)25)23(29)26-17-10-12-18(13-11-17)27-14-4-3-9-21(27)28/h5,7-8,10-13,15,20H,2-4,6,9,14H2,1H3,(H3,24,25)(H,26,29) |
| InChIKey | DPHAPEBQQXLMIH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|