C24H26N4O2 — CID 10201129
2-(3-carbamimidoylphenyl)-N-[4-(2-oxopiperidin-1-yl)phenyl]cyclopentene-1-carboxamide (PubChem CID 10201129) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenyl)-N-[4-(2-oxopiperidin-1-yl)phenyl]cyclopentene-1-carboxamide.
| Compound Name | 2-(3-carbamimidoylphenyl)-N-[4-(2-oxopiperidin-1-yl)phenyl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 10201129 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(3-carbamimidoylphenyl)-N-[4-(2-oxopiperidin-1-yl)phenyl]cyclopentene-1-carboxamide |
| SMILES | [H]/N=C(\N)c1cccc(C2=C(C(=O)Nc3ccc(N4CCCCC4=O)cc3)CCC2)c1 |
| InChI | InChI=1S/C24H26N4O2/c25-23(26)17-6-3-5-16(15-17)20-7-4-8-21(20)24(30)27-18-10-12-19(13-11-18)28-14-2-1-9-22(28)29/h3,5-6,10-13,15H,1-2,4,7-9,14H2,(H3,25,26)(H,27,30) |
| InChIKey | BYBIROJMERLNMP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|