C22H24N4O5 — CID 141059156
[1-(3-carbamimidoylphenoxy)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl] acetate (PubChem CID 141059156) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is [1-(3-carbamimidoylphenoxy)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl] acetate.
| Compound Name | [1-(3-carbamimidoylphenoxy)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl] acetate |
|---|---|
| PubChem CID | 141059156 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [1-(3-carbamimidoylphenoxy)-2-oxo-2-[4-(2-oxopiperidin-1-yl)anilino]ethyl] acetate |
| SMILES | [H]/N=C(\N)c1cccc(OC(OC(C)=O)C(=O)Nc2ccc(N3CCCCC3=O)cc2)c1 |
| InChI | InChI=1S/C22H24N4O5/c1-14(27)30-22(31-18-6-4-5-15(13-18)20(23)24)21(29)25-16-8-10-17(11-9-16)26-12-3-2-7-19(26)28/h4-6,8-11,13,22H,2-3,7,12H2,1H3,(H3,23,24)(H,25,29) |
| InChIKey | MALIYCUDJHCWGQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|