C25H30N4O6 — CID 58962780
[(Z)-[amino-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxyphenyl]methylidene]amino] methyl carbonate (PubChem CID 58962780) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is [(Z)-[amino-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxyphenyl]methylidene]amino] methyl carbonate.
| Compound Name | [(Z)-[amino-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxyphenyl]methylidene]amino] methyl carbonate |
|---|---|
| PubChem CID | 58962780 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | [(Z)-[amino-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxyphenyl]methylidene]amino] methyl carbonate |
| SMILES | CCCC(Oc1cccc(/C(N)=N/OC(=O)OC)c1)C(=O)Nc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C25H30N4O6/c1-3-7-21(34-20-9-6-8-17(16-20)23(26)28-35-25(32)33-2)24(31)27-18-11-13-19(14-12-18)29-15-5-4-10-22(29)30/h6,8-9,11-14,16,21H,3-5,7,10,15H2,1-2H3,(H2,26,28)(H,27,31) |
| InChIKey | LGEORZNITYQHIH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|