C26H32N4O5 — CID 173161311
ethyl N-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxybenzenecarboximidoyl]carbamate (PubChem CID 173161311) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is ethyl N-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxybenzenecarboximidoyl]carbamate.
| Compound Name | ethyl N-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxybenzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173161311 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | ethyl N-[3-[1-oxo-1-[4-(2-oxopiperidin-1-yl)anilino]pentan-2-yl]oxybenzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCC)c1cccc(OC(CCC)C(=O)Nc2ccc(N3CCCCC3=O)cc2)c1 |
| InChI | InChI=1S/C26H32N4O5/c1-3-8-22(35-21-10-7-9-18(17-21)24(27)29-26(33)34-4-2)25(32)28-19-12-14-20(15-13-19)30-16-6-5-11-23(30)31/h7,9-10,12-15,17,22H,3-6,8,11,16H2,1-2H3,(H,28,32)(H2,27,29,33) |
| InChIKey | DVSCADSHBQOGJK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|