C27H28N4O3 — CID 69337970
2-(3-carbamimidoylphenoxy)-N-[2-methyl-4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide (PubChem CID 69337970) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[2-methyl-4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[2-methyl-4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 69337970 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[2-methyl-4-(2-oxopiperidin-1-yl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(OC(C(=O)Nc2ccc(N3CCCCC3=O)cc2C)c2ccccc2)c1 |
| InChI | InChI=1S/C27H28N4O3/c1-18-16-21(31-15-6-5-12-24(31)32)13-14-23(18)30-27(33)25(19-8-3-2-4-9-19)34-22-11-7-10-20(17-22)26(28)29/h2-4,7-11,13-14,16-17,25H,5-6,12,15H2,1H3,(H3,28,29)(H,30,33) |
| InChIKey | WEFNDVMHVQEOPN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|