C25H24N4O4 — CID 10297265
2-(3-carbamimidoylphenoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-2-phenylacetamide (PubChem CID 10297265) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-(3-carbamimidoylphenoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-(3-carbamimidoylphenoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 10297265 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-(3-carbamimidoylphenoxy)-N-[4-(3-oxomorpholin-4-yl)phenyl]-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(OC(C(=O)Nc2ccc(N3CCOCC3=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N4O4/c26-24(27)18-7-4-8-21(15-18)33-23(17-5-2-1-3-6-17)25(31)28-19-9-11-20(12-10-19)29-13-14-32-16-22(29)30/h1-12,15,23H,13-14,16H2,(H3,26,27)(H,28,31) |
| InChIKey | OWEAGENFVFFYJI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|