C25H26ClN5O7 — CID 76717235
[2-(4-carbamimidoyl-3-chloroanilino)-2-oxo-1-[3-oxo-4-[3-(3-oxomorpholin-4-yl)phenyl]morpholin-2-yl]ethyl] acetate (PubChem CID 76717235) has the molecular formula C25H26ClN5O7 and a molecular weight of 543.96 g/mol. Its IUPAC name is [2-(4-carbamimidoyl-3-chloroanilino)-2-oxo-1-[3-oxo-4-[3-(3-oxomorpholin-4-yl)phenyl]morpholin-2-yl]ethyl] acetate.
| Compound Name | [2-(4-carbamimidoyl-3-chloroanilino)-2-oxo-1-[3-oxo-4-[3-(3-oxomorpholin-4-yl)phenyl]morpholin-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 76717235 |
| Molecular Formula | C25H26ClN5O7 |
| Molecular Weight | 543.96 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | [2-(4-carbamimidoyl-3-chloroanilino)-2-oxo-1-[3-oxo-4-[3-(3-oxomorpholin-4-yl)phenyl]morpholin-2-yl]ethyl] acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)C(OC(C)=O)C2OCCN(c3cccc(N4CCOCC4=O)c3)C2=O)cc1Cl |
| InChI | InChI=1S/C25H26ClN5O7/c1-14(32)38-21(24(34)29-15-5-6-18(23(27)28)19(26)11-15)22-25(35)31(8-10-37-22)17-4-2-3-16(12-17)30-7-9-36-13-20(30)33/h2-6,11-12,21-22H,7-10,13H2,1H3,(H3,27,28)(H,29,34) |
| InChIKey | XVHBCVVKWIWNPN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 164.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.96 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|