C22H26N4O4 — CID 91444985
2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanamide (PubChem CID 91444985) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanamide.
| Compound Name | 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 91444985 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[3-(N'-hydroxycarbamimidoyl)phenoxy]-N-[4-(2-oxopiperidin-1-yl)phenyl]butanamide |
| SMILES | CCC(Oc1cccc(C(N)=NO)c1)C(=O)Nc1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C22H26N4O4/c1-2-19(30-18-7-5-6-15(14-18)21(23)25-29)22(28)24-16-9-11-17(12-10-16)26-13-4-3-8-20(26)27/h5-7,9-12,14,19,29H,2-4,8,13H2,1H3,(H2,23,25)(H,24,28) |
| InChIKey | XZGMKLDCTFTQMD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 117.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|