C12H17N3O5S — CID 107565988
(2R)-2-[(3-sulfamoylphenyl)carbamoylamino]pentanoic acid (PubChem CID 107565988) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is (2R)-2-[(3-sulfamoylphenyl)carbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-[(3-sulfamoylphenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107565988 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2R)-2-[(3-sulfamoylphenyl)carbamoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)Nc1cccc(S(N)(=O)=O)c1)C(=O)O |
| InChI | InChI=1S/C12H17N3O5S/c1-2-4-10(11(16)17)15-12(18)14-8-5-3-6-9(7-8)21(13,19)20/h3,5-7,10H,2,4H2,1H3,(H,16,17)(H2,13,19,20)(H2,14,15,18)/t10-/m1/s1 |
| InChIKey | RSRVUXKDQYNXQH-SNVBAGLBSA-N |
| XLogP | 0.71 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |