C13H17N3O7S — CID 166627768
dimethyl 2-[(3-sulfamoylphenyl)carbamoylamino]butanedioate (PubChem CID 166627768) has the molecular formula C13H17N3O7S and a molecular weight of 359.36 g/mol. Its IUPAC name is dimethyl 2-[(3-sulfamoylphenyl)carbamoylamino]butanedioate.
| Compound Name | dimethyl 2-[(3-sulfamoylphenyl)carbamoylamino]butanedioate |
|---|---|
| PubChem CID | 166627768 |
| Molecular Formula | C13H17N3O7S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | dimethyl 2-[(3-sulfamoylphenyl)carbamoylamino]butanedioate |
| SMILES | COC(=O)CC(NC(=O)Nc1cccc(S(N)(=O)=O)c1)C(=O)OC |
| InChI | InChI=1S/C13H17N3O7S/c1-22-11(17)7-10(12(18)23-2)16-13(19)15-8-4-3-5-9(6-8)24(14,20)21/h3-6,10H,7H2,1-2H3,(H2,14,20,21)(H2,15,16,19) |
| InChIKey | VRRLDXYCMAQCOM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |