C17H21N3O5S — CID 47065590
1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 47065590) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 47065590 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | COc1ccc(C(C)NC(=O)Nc2cccc(S(N)(=O)=O)c2)cc1OC |
| InChI | InChI=1S/C17H21N3O5S/c1-11(12-7-8-15(24-2)16(9-12)25-3)19-17(21)20-13-5-4-6-14(10-13)26(18,22)23/h4-11H,1-3H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | VOXBYIWVBHFXAG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |