C19H21N3O3 — CID 95312253
1-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-indol-5-yl)urea (PubChem CID 95312253) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-indol-5-yl)urea.
| Compound Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 95312253 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(1S)-1-(3,4-dimethoxyphenyl)ethyl]-3-(1H-indol-5-yl)urea |
| SMILES | COc1ccc([C@H](C)NC(=O)Nc2ccc3[nH]ccc3c2)cc1OC |
| InChI | InChI=1S/C19H21N3O3/c1-12(13-4-7-17(24-2)18(11-13)25-3)21-19(23)22-15-5-6-16-14(10-15)8-9-20-16/h4-12,20H,1-3H3,(H2,21,22,23)/t12-/m0/s1 |
| InChIKey | ZBCSCVHMMGWOOH-LBPRGKRZSA-N |
| XLogP | 4.07 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |