C16H21N3O3 — CID 124625330
ethyl (2R,3S)-3-(1H-indol-5-ylcarbamoylamino)-2-methylbutanoate (PubChem CID 124625330) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(1H-indol-5-ylcarbamoylamino)-2-methylbutanoate.
| Compound Name | ethyl (2R,3S)-3-(1H-indol-5-ylcarbamoylamino)-2-methylbutanoate |
|---|---|
| PubChem CID | 124625330 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | ethyl (2R,3S)-3-(1H-indol-5-ylcarbamoylamino)-2-methylbutanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H](C)NC(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H21N3O3/c1-4-22-15(20)10(2)11(3)18-16(21)19-13-5-6-14-12(9-13)7-8-17-14/h5-11,17H,4H2,1-3H3,(H2,18,19,21)/t10-,11+/m1/s1 |
| InChIKey | GJWGHFZVKXSXPJ-MNOVXSKESA-N |
| XLogP | 2.88 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |