C14H19FN2O3 — CID 99783914
ethyl (2S,3S)-3-[(3-fluorophenyl)carbamoylamino]-2-methylbutanoate (PubChem CID 99783914) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(3-fluorophenyl)carbamoylamino]-2-methylbutanoate.
| Compound Name | ethyl (2S,3S)-3-[(3-fluorophenyl)carbamoylamino]-2-methylbutanoate |
|---|---|
| PubChem CID | 99783914 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl (2S,3S)-3-[(3-fluorophenyl)carbamoylamino]-2-methylbutanoate |
| SMILES | CCOC(=O)[C@@H](C)[C@H](C)NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H19FN2O3/c1-4-20-13(18)9(2)10(3)16-14(19)17-12-7-5-6-11(15)8-12/h5-10H,4H2,1-3H3,(H2,16,17,19)/t9-,10-/m0/s1 |
| InChIKey | AQGGDUWSKHUCLR-UWVGGRQHSA-N |
| XLogP | 2.53 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |