C17H25N3O2 — CID 111521138
1-(2,2-diethyl-4-hydroxybutyl)-3-(1H-indol-5-yl)urea (PubChem CID 111521138) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-(1H-indol-5-yl)urea.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 111521138 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(1H-indol-5-yl)urea |
| SMILES | CCC(CC)(CCO)CNC(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-17(4-2,8-10-21)12-19-16(22)20-14-5-6-15-13(11-14)7-9-18-15/h5-7,9,11,18,21H,3-4,8,10,12H2,1-2H3,(H2,19,20,22) |
| InChIKey | ODWFSDTZENYGQS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |