C17H25N3O2 — CID 111453354
1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-5-yl)urea (PubChem CID 111453354) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-5-yl)urea.
| Compound Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 111453354 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-5-yl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C17H25N3O2/c1-12(2)6-8-17(3,22)11-19-16(21)20-14-4-5-15-13(10-14)7-9-18-15/h4-5,7,9-10,12,18,22H,6,8,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | CQXKJCYMRTYGFQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |