About 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea
1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea (PubChem CID 111454969) has the molecular formula C18H27N3O2
and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea |
| PubChem CID | 111454969 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea |
| SMILES | CC(C)CCC(C)(O)CNC(=O)NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H27N3O2/c1-13(2)8-9-18(3,23)12-20-17(22)19-11-15-10-14-6-4-5-7-16(14)21-15/h4-7,10,13,21,23H,8-9,11-12H2,1-3H3,(H2,19,20,22) |
| InChIKey | JQKVBNDIOPGVBE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea?
The IUPAC name of 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea (CID 111454969) is 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea.
What is the SMILES notation for 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea?
The canonical SMILES for 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea is CC(C)CCC(C)(O)CNC(=O)NCc1cc2ccccc2[nH]1.
What is the InChIKey of 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea?
The InChIKey is JQKVBNDIOPGVBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2/c1-13(2)8-9-18(3,23)12-20-17(22)19-11-15-10-14-6-4-5-7-16(14)21-15/h4-7,10,13,21,23H,8-9,11-12H2,1-3H3,(H2,19,20,22).
What are the key properties of 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea?
1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea has a molecular weight of 317.43 g/mol, XLogP of 3.15, 7 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-2,5-dimethylhexyl)-3-(1H-indol-2-ylmethyl)urea is sourced from PubChem (CID 111454969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).