C17H20N4OS — CID 75521331
1-(1H-indol-2-ylmethyl)-3-[2-(5-methyl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 75521331) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(1H-indol-2-ylmethyl)-3-[2-(5-methyl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-(1H-indol-2-ylmethyl)-3-[2-(5-methyl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 75521331 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(1H-indol-2-ylmethyl)-3-[2-(5-methyl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | Cc1cnc(C(C)CNC(=O)NCc2cc3ccccc3[nH]2)s1 |
| InChI | InChI=1S/C17H20N4OS/c1-11(16-18-9-12(2)23-16)8-19-17(22)20-10-14-7-13-5-3-4-6-15(13)21-14/h3-7,9,11,21H,8,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | IIRFBJSAMJCADX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |