C18H17F2N3O2 — CID 111454971
1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(1H-indol-2-ylmethyl)urea (PubChem CID 111454971) has the molecular formula C18H17F2N3O2 and a molecular weight of 345.35 g/mol. Its IUPAC name is 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(1H-indol-2-ylmethyl)urea.
| Compound Name | 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(1H-indol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 111454971 |
| Molecular Formula | C18H17F2N3O2 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(1H-indol-2-ylmethyl)urea |
| SMILES | O=C(NCc1cc2ccccc2[nH]1)NCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C18H17F2N3O2/c19-13-5-3-6-14(20)17(13)16(24)10-22-18(25)21-9-12-8-11-4-1-2-7-15(11)23-12/h1-8,16,23-24H,9-10H2,(H2,21,22,25) |
| InChIKey | ISQFSKDVBCAVTP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |