C17H15BrFN3O — CID 86870795
1-[(2-bromo-5-fluorophenyl)methyl]-3-(1H-indol-2-ylmethyl)urea (PubChem CID 86870795) has the molecular formula C17H15BrFN3O and a molecular weight of 376.23 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-3-(1H-indol-2-ylmethyl)urea.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-(1H-indol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 86870795 |
| Molecular Formula | C17H15BrFN3O |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-(1H-indol-2-ylmethyl)urea |
| SMILES | O=C(NCc1cc2ccccc2[nH]1)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C17H15BrFN3O/c18-15-6-5-13(19)7-12(15)9-20-17(23)21-10-14-8-11-3-1-2-4-16(11)22-14/h1-8,22H,9-10H2,(H2,20,21,23) |
| InChIKey | ZTKDTPPFXZUJEB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |