C16H12ClFN2O — CID 46921177
N-[(2-chloro-4-fluorophenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 46921177) has the molecular formula C16H12ClFN2O and a molecular weight of 302.74 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46921177 |
| Molecular Formula | C16H12ClFN2O |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1Cl)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H12ClFN2O/c17-13-8-12(18)6-5-11(13)9-19-16(21)15-7-10-3-1-2-4-14(10)20-15/h1-8,20H,9H2,(H,19,21) |
| InChIKey | ODKAPTGRISGNFO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |