C16H15BN2O3 — CID 140927918
[4-[(1H-indole-2-carbonylamino)methyl]phenyl]boronic acid (PubChem CID 140927918) has the molecular formula C16H15BN2O3 and a molecular weight of 294.12 g/mol. Its IUPAC name is [4-[(1H-indole-2-carbonylamino)methyl]phenyl]boronic acid.
| Compound Name | [4-[(1H-indole-2-carbonylamino)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 140927918 |
| Molecular Formula | C16H15BN2O3 |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [4-[(1H-indole-2-carbonylamino)methyl]phenyl]boronic acid |
| SMILES | O=C(NCc1ccc(B(O)O)cc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15BN2O3/c20-16(15-9-12-3-1-2-4-14(12)19-15)18-10-11-5-7-13(8-6-11)17(21)22/h1-9,19,21-22H,10H2,(H,18,20) |
| InChIKey | ZTLULQNDZPRVTG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|