C16H13BrN2O — CID 46921176
N-[(4-bromophenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 46921176) has the molecular formula C16H13BrN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | N-[(4-bromophenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46921176 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H13BrN2O/c17-13-7-5-11(6-8-13)10-18-16(20)15-9-12-3-1-2-4-14(12)19-15/h1-9,19H,10H2,(H,18,20) |
| InChIKey | LJSUNYFTLBVJAL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |